C16H23N5O10P2 — CID 11192200
[(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 11192200) has the molecular formula C16H23N5O10P2 and a molecular weight of 507.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11192200 |
| Molecular Formula | C16H23N5O10P2 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-hex-1-ynylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CCCCC#Cc1nc(N)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H23N5O10P2/c1-2-3-4-5-6-10-19-14(17)11-15(20-10)21(8-18-11)16-13(23)12(22)9(30-16)7-29-33(27,28)31-32(24,25)26/h8-9,12-13,16,22-23H,2-4,7H2,1H3,(H,27,28)(H2,17,19,20)(H2,24,25,26)/t9-,12-,13-,16-/m1/s1 |
| InChIKey | ZJPPQZWXGCJYRT-RVXWVPLUSA-N |
| XLogP | -0.20 |
| TPSA | 232.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|