C21H29N5O5 — CID 54151173
(2R,3R,4S,5R)-2-[6-amino-2-[4-(1-hydroxycycloheptyl)but-1-ynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 54151173) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[4-(1-hydroxycycloheptyl)but-1-ynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[4-(1-hydroxycycloheptyl)but-1-ynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54151173 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[4-(1-hydroxycycloheptyl)but-1-ynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(C#CCCC2(O)CCCCCC2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H29N5O5/c22-18-15-19(26(12-23-15)20-17(29)16(28)13(11-27)31-20)25-14(24-18)7-3-6-10-21(30)8-4-1-2-5-9-21/h12-13,16-17,20,27-30H,1-2,4-6,8-11H2,(H2,22,24,25)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | OHVOTODAQNCUFB-AEVYOOLXSA-N |
| XLogP | 0.24 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|