C14H16IN5O4 — CID 89167313
(3R,4S)-2-[6-amino-2-(3-iodobut-1-ynyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 89167313) has the molecular formula C14H16IN5O4 and a molecular weight of 445.22 g/mol. Its IUPAC name is (3R,4S)-2-[6-amino-2-(3-iodobut-1-ynyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S)-2-[6-amino-2-(3-iodobut-1-ynyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 89167313 |
| Molecular Formula | C14H16IN5O4 |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | (3R,4S)-2-[6-amino-2-(3-iodobut-1-ynyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(I)C#Cc1nc(N)c2ncn(C3OC(CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C14H16IN5O4/c1-6(15)2-3-8-18-12(16)9-13(19-8)20(5-17-9)14-11(23)10(22)7(4-21)24-14/h5-7,10-11,14,21-23H,4H2,1H3,(H2,16,18,19)/t6?,7?,10-,11-,14?/m1/s1 |
| InChIKey | UTOGDZODROFMBQ-GFRMHVANSA-N |
| XLogP | -0.81 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|