C17H21N5O5 — CID 46875406
(3R,4S,5R)-2-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46875406) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46875406 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (3R,4S,5R)-2-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(C#CC2(O)CCCC2)nc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H21N5O5/c18-14-11-15(21-10(20-14)3-6-17(26)4-1-2-5-17)22(8-19-11)16-13(25)12(24)9(7-23)27-16/h8-9,12-13,16,23-26H,1-2,4-5,7H2,(H2,18,20,21)/t9-,12-,13-,16?/m1/s1 |
| InChIKey | JEPMZJFYPKIARB-VTRSQVMYSA-N |
| XLogP | -1.32 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|