C23H34N6O5 — CID 159596190
(2S,4S,5R)-5-[6-amino-2-[2-[(1S)-1-hydroxy-3,3-dimethylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide;methane (PubChem CID 159596190) has the molecular formula C23H34N6O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (2S,4S,5R)-5-[6-amino-2-[2-[(1S)-1-hydroxy-3,3-dimethylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide;methane.
| Compound Name | (2S,4S,5R)-5-[6-amino-2-[2-[(1S)-1-hydroxy-3,3-dimethylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide;methane |
|---|---|
| PubChem CID | 159596190 |
| Molecular Formula | C23H34N6O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (2S,4S,5R)-5-[6-amino-2-[2-[(1S)-1-hydroxy-3,3-dimethylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide;methane |
| SMILES | C.CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#C[C@]4(O)CCCC(C)(C)C4)nc32)[C@@H](O)C1O |
| InChI | InChI=1S/C22H30N6O5.CH4/c1-4-24-19(31)16-14(29)15(30)20(33-16)28-11-25-13-17(23)26-12(27-18(13)28)6-9-22(32)8-5-7-21(2,3)10-22;/h11,14-16,20,29-30,32H,4-5,7-8,10H2,1-3H3,(H,24,31)(H2,23,26,27);1H4/t14?,15-,16-,20+,22+;/m0./s1 |
| InChIKey | MKWJVIWRXSFGTC-ABHWKAJGSA-N |
| XLogP | 0.48 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|