C24H32N6O6 — CID 58860490
(2S,3R,5R)-5-[6-amino-2-[2-[(2R,3S)-2,3-dihydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 58860490) has the molecular formula C24H32N6O6 and a molecular weight of 500.56 g/mol. Its IUPAC name is (2S,3R,5R)-5-[6-amino-2-[2-[(2R,3S)-2,3-dihydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3R,5R)-5-[6-amino-2-[2-[(2R,3S)-2,3-dihydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 58860490 |
| Molecular Formula | C24H32N6O6 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | (2S,3R,5R)-5-[6-amino-2-[2-[(2R,3S)-2,3-dihydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#C[C@@]4(O)CC5CC(C5(C)C)[C@@]4(C)O)nc32)C(O)[C@H]1O |
| InChI | InChI=1S/C24H32N6O6/c1-5-26-20(33)17-15(31)16(32)21(36-17)30-10-27-14-18(25)28-13(29-19(14)30)6-7-24(35)9-11-8-12(22(11,2)3)23(24,4)34/h10-12,15-17,21,31-32,34-35H,5,8-9H2,1-4H3,(H,26,33)(H2,25,28,29)/t11?,12?,15-,16?,17+,21-,23-,24-/m1/s1 |
| InChIKey | HYBLEXMXENXJBE-ISCGPJSLSA-N |
| XLogP | -0.94 |
| TPSA | 188.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|