C21H28N6O5 — CID 58860560
(2S,3R,5R)-5-[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 58860560) has the molecular formula C21H28N6O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is (2S,3R,5R)-5-[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3R,5R)-5-[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 58860560 |
| Molecular Formula | C21H28N6O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (2S,3R,5R)-5-[6-amino-2-[2-[(1S,3R)-1-hydroxy-3-methylcyclohexyl]ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#C[C@]4(O)CCC[C@@H](C)C4)nc32)C(O)[C@H]1O |
| InChI | InChI=1S/C21H28N6O5/c1-3-23-19(30)16-14(28)15(29)20(32-16)27-10-24-13-17(22)25-12(26-18(13)27)6-8-21(31)7-4-5-11(2)9-21/h10-11,14-16,20,28-29,31H,3-5,7,9H2,1-2H3,(H,23,30)(H2,22,25,26)/t11-,14-,15?,16+,20-,21-/m1/s1 |
| InChIKey | LPBZJFSNWFIUOV-HBKAJBAFSA-N |
| XLogP | -0.54 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|