C13H15N6O9P — CID 118478640
2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid (PubChem CID 118478640) has the molecular formula C13H15N6O9P and a molecular weight of 430.27 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 118478640 |
| Molecular Formula | C13H15N6O9P |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-cyanopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
| SMILES | N#Cc1nc(N)c2ncn([C@@H]3O[C@H](COC(C(=O)O)P(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C13H15N6O9P/c14-1-5-17-9(15)6-10(18-5)19(3-16-6)11-8(21)7(20)4(28-11)2-27-13(12(22)23)29(24,25)26/h3-4,7-8,11,13,20-21H,2H2,(H,22,23)(H2,15,17,18)(H2,24,25,26)/t4-,7-,8-,11-,13?/m1/s1 |
| InChIKey | NSJVVFIPXXVIET-YKWPVECPSA-N |
| XLogP | -2.50 |
| TPSA | 247.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|