C13H21N7O3S — CID 154607063
(2S,3S,4R,5R)-2-(3-aminopropylsulfanylmethyl)-5-(2,6-diaminopurin-9-yl)oxolane-3,4-diol (PubChem CID 154607063) has the molecular formula C13H21N7O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(3-aminopropylsulfanylmethyl)-5-(2,6-diaminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(3-aminopropylsulfanylmethyl)-5-(2,6-diaminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 154607063 |
| Molecular Formula | C13H21N7O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2S,3S,4R,5R)-2-(3-aminopropylsulfanylmethyl)-5-(2,6-diaminopurin-9-yl)oxolane-3,4-diol |
| SMILES | NCCCSC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H21N7O3S/c14-2-1-3-24-4-6-8(21)9(22)12(23-6)20-5-17-7-10(15)18-13(16)19-11(7)20/h5-6,8-9,12,21-22H,1-4,14H2,(H4,15,16,18,19)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | XSXKJGCJUZRZEL-WOUKDFQISA-N |
| XLogP | -1.31 |
| TPSA | 171.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|