C12H18N6O4S — CID 45268893
(2R,3R,4S,5S)-2-(2,6-diaminopurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 45268893) has the molecular formula C12H18N6O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(2,6-diaminopurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(2,6-diaminopurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 45268893 |
| Molecular Formula | C12H18N6O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R,3R,4S,5S)-2-(2,6-diaminopurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(N)c2ncn([C@@H]3O[C@H](CSCCO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C12H18N6O4S/c13-9-6-10(17-12(14)16-9)18(4-15-6)11-8(21)7(20)5(22-11)3-23-2-1-19/h4-5,7-8,11,19-21H,1-3H2,(H4,13,14,16,17)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | UILKZQMRAHJKRD-IOSLPCCCSA-N |
| XLogP | -1.66 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|