C11H13F2N5O2 — CID 58192994
(2R,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethyl-4-fluorooxolan-3-ol (PubChem CID 58192994) has the molecular formula C11H13F2N5O2 and a molecular weight of 285.25 g/mol. Its IUPAC name is (2R,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethyl-4-fluorooxolan-3-ol.
| Compound Name | (2R,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethyl-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 58192994 |
| Molecular Formula | C11H13F2N5O2 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2R,4S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethyl-4-fluorooxolan-3-ol |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@@H](F)C1O |
| InChI | InChI=1S/C11H13F2N5O2/c1-2-4-7(19)5(12)10(20-4)18-3-15-6-8(14)16-11(13)17-9(6)18/h3-5,7,10,19H,2H2,1H3,(H2,14,16,17)/t4-,5+,7?,10-/m1/s1 |
| InChIKey | HNUHRPVEXHFRGE-WROBTOGHSA-N |
| XLogP | 0.55 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |