C15H24N6O4 — CID 91126987
(3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)-4-pentoxyoxolan-3-ol (PubChem CID 91126987) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)-4-pentoxyoxolan-3-ol.
| Compound Name | (3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)-4-pentoxyoxolan-3-ol |
|---|---|
| PubChem CID | 91126987 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (3R,4S,5R)-2-(2,6-diaminopurin-9-yl)-5-(hydroxymethyl)-4-pentoxyoxolan-3-ol |
| SMILES | CCCCCO[C@@H]1[C@@H](CO)OC(n2cnc3c(N)nc(N)nc32)[C@@H]1O |
| InChI | InChI=1S/C15H24N6O4/c1-2-3-4-5-24-11-8(6-22)25-14(10(11)23)21-7-18-9-12(16)19-15(17)20-13(9)21/h7-8,10-11,14,22-23H,2-6H2,1H3,(H4,16,17,19,20)/t8-,10-,11-,14?/m1/s1 |
| InChIKey | XYHVOKXYNVIWMI-OYBGHCQBSA-N |
| XLogP | -0.18 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|