C25H42FN5O4 — CID 67644397
9-[(2R,3R,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2-fluoropurin-6-amine (PubChem CID 67644397) has the molecular formula C25H42FN5O4 and a molecular weight of 495.64 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2-fluoropurin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 67644397 |
| Molecular Formula | C25H42FN5O4 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3,4-dipentoxy-5-(pentoxymethyl)oxolan-2-yl]-2-fluoropurin-6-amine |
| SMILES | CCCCCOC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@H](OCCCCC)[C@@H]1OCCCCC |
| InChI | InChI=1S/C25H42FN5O4/c1-4-7-10-13-32-16-18-20(33-14-11-8-5-2)21(34-15-12-9-6-3)24(35-18)31-17-28-19-22(27)29-25(26)30-23(19)31/h17-18,20-21,24H,4-16H2,1-3H3,(H2,27,29,30)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | VCDPISBRUKLWSW-UMCMBGNQSA-N |
| XLogP | 4.80 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|