C29H49ClN4O6 — CID 89338624
6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-methoxyoxepan-2-yl]purine (PubChem CID 89338624) has the molecular formula C29H49ClN4O6 and a molecular weight of 585.19 g/mol. Its IUPAC name is 6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-methoxyoxepan-2-yl]purine.
| Compound Name | 6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-methoxyoxepan-2-yl]purine |
|---|---|
| PubChem CID | 89338624 |
| Molecular Formula | C29H49ClN4O6 |
| Molecular Weight | 585.19 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-methoxyoxepan-2-yl]purine |
| SMILES | CCCCOC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](OC)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H49ClN4O6/c1-6-10-14-36-18-21-23(37-15-11-7-2)24(38-16-12-8-3)25(39-17-13-9-4)26(35-5)29(40-21)34-20-33-22-27(30)31-19-32-28(22)34/h19-21,23-26,29H,6-18H2,1-5H3/t21-,23-,24+,25-,26-,29-/m1/s1 |
| InChIKey | YZWVSHRBNFLJLI-UDEAPPIESA-N |
| XLogP | 5.76 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.19 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|