C29H48ClFN4O5 — CID 89338530
6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-fluoro-3-methyloxepan-2-yl]purine (PubChem CID 89338530) has the molecular formula C29H48ClFN4O5 and a molecular weight of 587.18 g/mol. Its IUPAC name is 6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-fluoro-3-methyloxepan-2-yl]purine.
| Compound Name | 6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-fluoro-3-methyloxepan-2-yl]purine |
|---|---|
| PubChem CID | 89338530 |
| Molecular Formula | C29H48ClFN4O5 |
| Molecular Weight | 587.18 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 6-chloro-9-[(2R,3R,4R,5S,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)-3-fluoro-3-methyloxepan-2-yl]purine |
| SMILES | CCCCOC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@](C)(F)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H48ClFN4O5/c1-6-10-14-36-18-21-23(37-15-11-7-2)24(38-16-12-8-3)25(39-17-13-9-4)29(5,31)28(40-21)35-20-34-22-26(30)32-19-33-27(22)35/h19-21,23-25,28H,6-18H2,1-5H3/t21-,23-,24+,25-,28-,29-/m1/s1 |
| InChIKey | QBHNJPLZJUJTHA-RNJCZXTGSA-N |
| XLogP | 6.48 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.18 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|