C28H47ClN4O5 — CID 89338423
6-chloro-9-[(2R,4S,5R,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)oxepan-2-yl]purine (PubChem CID 89338423) has the molecular formula C28H47ClN4O5 and a molecular weight of 555.16 g/mol. Its IUPAC name is 6-chloro-9-[(2R,4S,5R,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)oxepan-2-yl]purine.
| Compound Name | 6-chloro-9-[(2R,4S,5R,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)oxepan-2-yl]purine |
|---|---|
| PubChem CID | 89338423 |
| Molecular Formula | C28H47ClN4O5 |
| Molecular Weight | 555.16 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | 6-chloro-9-[(2R,4S,5R,6R,7R)-4,5,6-tributoxy-7-(butoxymethyl)oxepan-2-yl]purine |
| SMILES | CCCCOC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)C[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C28H47ClN4O5/c1-5-9-13-34-18-22-26(37-16-12-8-4)25(36-15-11-7-3)21(35-14-10-6-2)17-23(38-22)33-20-32-24-27(29)30-19-31-28(24)33/h19-23,25-26H,5-18H2,1-4H3/t21-,22+,23+,25+,26+/m0/s1 |
| InChIKey | TXOBUPBLISTXHF-VCILPBCZSA-N |
| XLogP | 6.14 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.16 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|