C24H48O5 — CID 71207120
(2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-7-methyloxepane (PubChem CID 71207120) has the molecular formula C24H48O5 and a molecular weight of 416.64 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-7-methyloxepane.
| Compound Name | (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-7-methyloxepane |
|---|---|
| PubChem CID | 71207120 |
| Molecular Formula | C24H48O5 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | (2R,3R,4R,5S)-3,4,5-tributoxy-2-(butoxymethyl)-7-methyloxepane |
| SMILES | CCCCOC[C@H]1OC(C)C[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C24H48O5/c1-6-10-14-25-19-22-24(28-17-13-9-4)23(27-16-12-8-3)21(18-20(5)29-22)26-15-11-7-2/h20-24H,6-19H2,1-5H3/t20?,21-,22+,23+,24+/m0/s1 |
| InChIKey | AKUHVKMJIYYNCS-OMENTWMHSA-N |
| XLogP | 5.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|