C30H44O5 — CID 121434659
(2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)-3,4-bis(phenylmethoxy)oxane (PubChem CID 121434659) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 121434659 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)-3,4-bis(phenylmethoxy)oxane |
| SMILES | CCCCCOC[C@H]1OC(OCCCCC)C[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H44O5/c1-3-5-13-19-31-24-28-30(34-23-26-17-11-8-12-18-26)27(33-22-25-15-9-7-10-16-25)21-29(35-28)32-20-14-6-4-2/h7-12,15-18,27-30H,3-6,13-14,19-24H2,1-2H3/t27-,28-,29?,30+/m1/s1 |
| InChIKey | LTJLIAPKZKNYGS-XUCOSLSWSA-N |
| XLogP | 6.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|