C43H58O10 — CID 102011102
(2R,3R,4S,5R,6S)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5,6-tris(phenylmethoxy)oxane (PubChem CID 102011102) has the molecular formula C43H58O10 and a molecular weight of 734.93 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5,6-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R,6S)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5,6-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 102011102 |
| Molecular Formula | C43H58O10 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | (2R,3R,4S,5R,6S)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5,6-tris(phenylmethoxy)oxane |
| SMILES | c1ccc(CO[C@H]2O[C@H](COCCCOC3CCCCO3)[C@@H](OCCCOC3CCCCO3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C43H58O10/c1-4-16-34(17-5-1)30-50-41-40(49-29-15-28-48-39-23-11-13-26-46-39)37(33-44-24-14-27-47-38-22-10-12-25-45-38)53-43(52-32-36-20-8-3-9-21-36)42(41)51-31-35-18-6-2-7-19-35/h1-9,16-21,37-43H,10-15,22-33H2/t37-,38?,39?,40-,41+,42-,43+/m1/s1 |
| InChIKey | BUQYZYHUFKKCSG-SEYDFIEUSA-N |
| XLogP | 7.37 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|