C42H51BrO6 — CID 166517588
(2R,3R,4S,5R)-2-(8-bromooctoxymethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane (PubChem CID 166517588) has the molecular formula C42H51BrO6 and a molecular weight of 731.77 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(8-bromooctoxymethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5R)-2-(8-bromooctoxymethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 166517588 |
| Molecular Formula | C42H51BrO6 |
| Molecular Weight | 731.77 g/mol |
| Exact Mass | 730.29 |
| IUPAC Name | (2R,3R,4S,5R)-2-(8-bromooctoxymethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane |
| SMILES | BrCCCCCCCCOC[C@H]1OC(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H51BrO6/c43-27-17-3-1-2-4-18-28-44-33-38-39(45-29-34-19-9-5-10-20-34)40(46-30-35-21-11-6-12-22-35)41(47-31-36-23-13-7-14-24-36)42(49-38)48-32-37-25-15-8-16-26-37/h5-16,19-26,38-42H,1-4,17-18,27-33H2/t38-,39-,40+,41-,42?/m1/s1 |
| InChIKey | ALNLIQXERDOWFG-QZUUWFBJSA-N |
| XLogP | 9.44 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.77 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|