C39H56O10 — CID 10908591
(2R,3R,4S,5R,6R)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane (PubChem CID 10908591) has the molecular formula C39H56O10 and a molecular weight of 684.87 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane.
| Compound Name | (2R,3R,4S,5R,6R)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 10908591 |
| Molecular Formula | C39H56O10 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-[3-(oxan-2-yloxy)propoxy]-2-[3-(oxan-2-yloxy)propoxymethyl]-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane |
| SMILES | C=CCO[C@@H]1O[C@H](COCCCOC2CCCCO2)[C@@H](OCCCOC2CCCCO2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H56O10/c1-2-21-46-39-38(48-29-32-17-7-4-8-18-32)37(47-28-31-15-5-3-6-16-31)36(45-27-14-26-44-35-20-10-12-24-42-35)33(49-39)30-40-22-13-25-43-34-19-9-11-23-41-34/h2-8,15-18,33-39H,1,9-14,19-30H2/t33-,34?,35?,36-,37+,38-,39-/m1/s1 |
| InChIKey | CSVFQMQMFMGZQF-QXXMFAKASA-N |
| XLogP | 6.35 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|