C36H44O6 — CID 101459333
(2R,3S,4R,6Z)-6-[4-(oxan-2-yloxy)butylidene]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane (PubChem CID 101459333) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is (2R,3S,4R,6Z)-6-[4-(oxan-2-yloxy)butylidene]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,4R,6Z)-6-[4-(oxan-2-yloxy)butylidene]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 101459333 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | (2R,3S,4R,6Z)-6-[4-(oxan-2-yloxy)butylidene]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
| SMILES | C(\CCCOC1CCCCO1)=C1/C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C36H44O6/c1-4-14-29(15-5-1)25-37-28-34-36(41-27-31-18-8-3-9-19-31)33(40-26-30-16-6-2-7-17-30)24-32(42-34)20-10-12-22-38-35-21-11-13-23-39-35/h1-9,14-20,33-36H,10-13,21-28H2/b32-20-/t33-,34-,35?,36+/m1/s1 |
| InChIKey | RRYTUCOGDVKLNZ-KSADMFKJSA-N |
| XLogP | 7.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|