C25H32O5 — CID 10835500
(2R,3S,5S)-5-(oxan-2-yloxy)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane (PubChem CID 10835500) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2R,3S,5S)-5-(oxan-2-yloxy)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,5S)-5-(oxan-2-yloxy)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10835500 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (2R,3S,5S)-5-(oxan-2-yloxy)-3-phenylmethoxy-2-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COC[C@H]2OC[C@@H](OC3CCCCO3)C[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H32O5/c1-3-9-20(10-4-1)16-26-19-24-23(28-17-21-11-5-2-6-12-21)15-22(18-29-24)30-25-13-7-8-14-27-25/h1-6,9-12,22-25H,7-8,13-19H2/t22-,23-,24+,25?/m0/s1 |
| InChIKey | GFZBZHJKZOJFHY-YTGPUZKVSA-N |
| XLogP | 4.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |