C32H36O5 — CID 100979308
(2R,3R,4S,4aR,10E)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,9-octahydropyrano[3,2-b]oxocine (PubChem CID 100979308) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is (2R,3R,4S,4aR,10E)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,9-octahydropyrano[3,2-b]oxocine.
| Compound Name | (2R,3R,4S,4aR,10E)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,9-octahydropyrano[3,2-b]oxocine |
|---|---|
| PubChem CID | 100979308 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2R,3R,4S,4aR,10E)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,6,7,8,9-octahydropyrano[3,2-b]oxocine |
| SMILES | C1=C2/O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCCCC/1 |
| InChI | InChI=1S/C32H36O5/c1-5-13-25(14-6-1)21-33-24-29-31(35-22-26-15-7-2-8-16-26)32(36-23-27-17-9-3-10-18-27)30-28(37-29)19-11-4-12-20-34-30/h1-3,5-10,13-19,29-32H,4,11-12,20-24H2/b28-19+/t29-,30+,31-,32-/m1/s1 |
| InChIKey | JPIBEKXFMLBWEI-GFKJGCTASA-N |
| XLogP | 6.23 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |