C31H36O7 — CID 102364580
[(2R,3R,4S,5R,6R)-6-[(2S)-oxolan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 102364580) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(2S)-oxolan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(2S)-oxolan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 102364580 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(2S)-oxolan-2-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | OC[C@H]1O[C@H](O[C@H]2CCCO2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H36O7/c32-19-26-28(34-20-23-11-4-1-5-12-23)29(35-21-24-13-6-2-7-14-24)30(36-22-25-15-8-3-9-16-25)31(37-26)38-27-17-10-18-33-27/h1-9,11-16,26-32H,10,17-22H2/t26-,27+,28-,29+,30-,31-/m1/s1 |
| InChIKey | WHMIJJQMENUJPN-ZAKLOLAYSA-N |
| XLogP | 4.61 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |