C16H32O5 — CID 121434694
(2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)oxane-3,4-diol (PubChem CID 121434694) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 121434694 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2R,3S,4R)-6-pentoxy-2-(pentoxymethyl)oxane-3,4-diol |
| SMILES | CCCCCOC[C@H]1OC(OCCCCC)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O5/c1-3-5-7-9-19-12-14-16(18)13(17)11-15(21-14)20-10-8-6-4-2/h13-18H,3-12H2,1-2H3/t13-,14-,15?,16+/m1/s1 |
| InChIKey | IUDBBSMMEDMENH-GXRBRPDZSA-N |
| XLogP | 2.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|