C15H32O5 — CID 144627259
ethane;6-heptoxy-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 144627259) has the molecular formula C15H32O5 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethane;6-heptoxy-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | ethane;6-heptoxy-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 144627259 |
| Molecular Formula | C15H32O5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethane;6-heptoxy-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC.CCCCCCCOC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C13H26O5.C2H6/c1-2-3-4-5-6-7-17-12-8-10(15)13(16)11(9-14)18-12;1-2/h10-16H,2-9H2,1H3;1-2H3 |
| InChIKey | KMFVCENBUHDIQW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|