C11H21NO6 — CID 172627567
5-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide (PubChem CID 172627567) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide.
| Compound Name | 5-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
|---|---|
| PubChem CID | 172627567 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
| SMILES | NC(=O)CCCCOC1CC(O)C(O)C(CO)O1 |
| InChI | InChI=1S/C11H21NO6/c12-9(15)3-1-2-4-17-10-5-7(14)11(16)8(6-13)18-10/h7-8,10-11,13-14,16H,1-6H2,(H2,12,15) |
| InChIKey | YOLWTEXZUNAEDU-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|