C13H25NO7 — CID 126510691
4-[2-[(2R,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]pentanamide (PubChem CID 126510691) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-[2-[(2R,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]pentanamide.
| Compound Name | 4-[2-[(2R,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]pentanamide |
|---|---|
| PubChem CID | 126510691 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-[2-[(2R,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]pentanamide |
| SMILES | CC(CCC(N)=O)OCCO[C@H]1C[C@@H](O)C(O)C(CO)O1 |
| InChI | InChI=1S/C13H25NO7/c1-8(2-3-11(14)17)19-4-5-20-12-6-9(16)13(18)10(7-15)21-12/h8-10,12-13,15-16,18H,2-7H2,1H3,(H2,14,17)/t8?,9-,10?,12-,13?/m1/s1 |
| InChIKey | CXLLMCGCWDFRGR-ZHPSYDNTSA-N |
| XLogP | -1.50 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|