About [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate
[(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate (PubChem CID 44608559) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate.
Analyze [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate?
The IUPAC name of [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate (CID 44608559) is [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate.
What is the SMILES notation for [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate?
The canonical SMILES for [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate is CC(=O)OC1C[C@@H](O)[C@H](O)[C@@H](CO)O1.
What is the InChIKey of [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate?
The InChIKey is YGBMPHYPPNPODX-UQYSTIMWSA-N. The full InChI is InChI=1S/C8H14O6/c1-4(10)13-7-2-5(11)8(12)6(3-9)14-7/h5-9,11-12H,2-3H2,1H3/t5-,6-,7?,8+/m1/s1.
What are the key properties of [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate?
[(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate has a molecular weight of 206.19 g/mol, XLogP of -1.62, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate is sourced from PubChem (CID 44608559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).