C12H22O6 — CID 178052000
6-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one (PubChem CID 178052000) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is 6-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one.
| Compound Name | 6-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one |
|---|---|
| PubChem CID | 178052000 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-[(2R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one |
| SMILES | CC(=O)CCCCO[C@H]1C[C@@H](O)[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C12H22O6/c1-8(14)4-2-3-5-17-11-6-9(15)12(16)10(7-13)18-11/h9-13,15-16H,2-7H2,1H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | FKROORHQFPKLAF-DDHJBXDOSA-N |
| XLogP | -0.41 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|