C10H20O5 — CID 102217415
(2R,3S,4R,6S)-6-butan-2-yloxy-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 102217415) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is (2R,3S,4R,6S)-6-butan-2-yloxy-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,6S)-6-butan-2-yloxy-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 102217415 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2R,3S,4R,6S)-6-butan-2-yloxy-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CCC(C)O[C@@H]1C[C@@H](O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H20O5/c1-3-6(2)14-9-4-7(12)10(13)8(5-11)15-9/h6-13H,3-5H2,1-2H3/t6?,7-,8-,9+,10+/m1/s1 |
| InChIKey | CQBFBMIQYKABFH-MHLYKNFOSA-N |
| XLogP | -0.37 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |