C10H20O4 — CID 58716425
(3R,6R)-6-tert-butyl-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 58716425) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (3R,6R)-6-tert-butyl-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3R,6R)-6-tert-butyl-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 58716425 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (3R,6R)-6-tert-butyl-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)[C@H]1CC(O)[C@@H](O)C(CO)O1 |
| InChI | InChI=1S/C10H20O4/c1-10(2,3)8-4-6(12)9(13)7(5-11)14-8/h6-9,11-13H,4-5H2,1-3H3/t6?,7?,8-,9-/m1/s1 |
| InChIKey | AZMULGAVZHBBSG-GEPGNKONSA-N |
| XLogP | -0.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |