C16H31NaO6 — CID 70170934
sodium (2S,3R,4S,5R,6R)-3-decoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate (PubChem CID 70170934) has the molecular formula C16H31NaO6 and a molecular weight of 342.41 g/mol. Its IUPAC name is sodium (2S,3R,4S,5R,6R)-3-decoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate.
| Compound Name | sodium (2S,3R,4S,5R,6R)-3-decoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate |
|---|---|
| PubChem CID | 70170934 |
| Molecular Formula | C16H31NaO6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | sodium (2S,3R,4S,5R,6R)-3-decoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate |
| SMILES | CCCCCCCCCCO[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1[O-].[Na+] |
| InChI | InChI=1S/C16H31O6.Na/c1-2-3-4-5-6-7-8-9-10-21-15-14(19)13(18)12(11-17)22-16(15)20;/h12-19H,2-11H2,1H3;/q-1;+1/t12-,13+,14+,15-,16+;/m1./s1 |
| InChIKey | XTPSPJBLXIHLET-QINYOJHVSA-N |
| XLogP | -2.68 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|