C16H33NaO6 — CID 173271818
sodium;(2S,3R,4S,5R,6R)-2-decoxy-6-(hydroxymethyl)oxane-3,4,5-triol;hydride (PubChem CID 173271818) has the molecular formula C16H33NaO6 and a molecular weight of 344.42 g/mol. Its IUPAC name is sodium;(2S,3R,4S,5R,6R)-2-decoxy-6-(hydroxymethyl)oxane-3,4,5-triol;hydride.
| Compound Name | sodium;(2S,3R,4S,5R,6R)-2-decoxy-6-(hydroxymethyl)oxane-3,4,5-triol;hydride |
|---|---|
| PubChem CID | 173271818 |
| Molecular Formula | C16H33NaO6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | sodium;(2S,3R,4S,5R,6R)-2-decoxy-6-(hydroxymethyl)oxane-3,4,5-triol;hydride |
| SMILES | CCCCCCCCCCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O.[H-].[Na+] |
| InChI | InChI=1S/C16H32O6.Na.H/c1-2-3-4-5-6-7-8-9-10-21-16-15(20)14(19)13(18)12(11-17)22-16;;/h12-20H,2-11H2,1H3;;/q;+1;-1/t12-,13+,14+,15-,16+;;/m1../s1 |
| InChIKey | KGTZKQFOSPYISY-IEVPIDTHSA-N |
| XLogP | -1.94 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|