C25H35NO3 — CID 70586172
(1R,2S,3R,5S)-N-methyl-2-pentoxy-3,5-bis(phenylmethoxy)cyclopentan-1-amine (PubChem CID 70586172) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is (1R,2S,3R,5S)-N-methyl-2-pentoxy-3,5-bis(phenylmethoxy)cyclopentan-1-amine.
| Compound Name | (1R,2S,3R,5S)-N-methyl-2-pentoxy-3,5-bis(phenylmethoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 70586172 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (1R,2S,3R,5S)-N-methyl-2-pentoxy-3,5-bis(phenylmethoxy)cyclopentan-1-amine |
| SMILES | CCCCCO[C@H]1[C@H](NC)[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H35NO3/c1-3-4-11-16-27-25-23(29-19-21-14-9-6-10-15-21)17-22(24(25)26-2)28-18-20-12-7-5-8-13-20/h5-10,12-15,22-26H,3-4,11,16-19H2,1-2H3/t22-,23+,24+,25+/m0/s1 |
| InChIKey | QUGAEVDTLUWDLN-ZYQDXHPFSA-N |
| XLogP | 4.72 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|