C36H55NO5 — CID 70583302
ethyl 6-[methyl-[(1S,2R,3S,5R)-2-octoxy-3,5-bis(phenylmethoxy)cyclopentyl]amino]hexanoate (PubChem CID 70583302) has the molecular formula C36H55NO5 and a molecular weight of 581.84 g/mol. Its IUPAC name is ethyl 6-[methyl-[(1S,2R,3S,5R)-2-octoxy-3,5-bis(phenylmethoxy)cyclopentyl]amino]hexanoate.
| Compound Name | ethyl 6-[methyl-[(1S,2R,3S,5R)-2-octoxy-3,5-bis(phenylmethoxy)cyclopentyl]amino]hexanoate |
|---|---|
| PubChem CID | 70583302 |
| Molecular Formula | C36H55NO5 |
| Molecular Weight | 581.84 g/mol |
| Exact Mass | 581.41 |
| IUPAC Name | ethyl 6-[methyl-[(1S,2R,3S,5R)-2-octoxy-3,5-bis(phenylmethoxy)cyclopentyl]amino]hexanoate |
| SMILES | CCCCCCCCO[C@@H]1[C@@H](N(C)CCCCCC(=O)OCC)[C@H](OCc2ccccc2)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H55NO5/c1-4-6-7-8-9-19-26-40-36-33(42-29-31-22-15-11-16-23-31)27-32(41-28-30-20-13-10-14-21-30)35(36)37(3)25-18-12-17-24-34(38)39-5-2/h10-11,13-16,20-23,32-33,35-36H,4-9,12,17-19,24-29H2,1-3H3/t32-,33+,35+,36+/m1/s1 |
| InChIKey | BVBKPSITCBXCPD-QMRYSSLUSA-N |
| XLogP | 7.73 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.84 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|