C35H53NO5 — CID 57046533
ethyl 6-[[(1S,2R,4S)-1-heptoxy-2,4-bis(phenylmethoxy)cyclopentyl]-methylamino]hexanoate (PubChem CID 57046533) has the molecular formula C35H53NO5 and a molecular weight of 567.81 g/mol. Its IUPAC name is ethyl 6-[[(1S,2R,4S)-1-heptoxy-2,4-bis(phenylmethoxy)cyclopentyl]-methylamino]hexanoate.
| Compound Name | ethyl 6-[[(1S,2R,4S)-1-heptoxy-2,4-bis(phenylmethoxy)cyclopentyl]-methylamino]hexanoate |
|---|---|
| PubChem CID | 57046533 |
| Molecular Formula | C35H53NO5 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 567.39 |
| IUPAC Name | ethyl 6-[[(1S,2R,4S)-1-heptoxy-2,4-bis(phenylmethoxy)cyclopentyl]-methylamino]hexanoate |
| SMILES | CCCCCCCO[C@@]1(N(C)CCCCCC(=O)OCC)C[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H53NO5/c1-4-6-7-8-18-25-41-35(36(3)24-17-11-16-23-34(37)38-5-2)27-32(39-28-30-19-12-9-13-20-30)26-33(35)40-29-31-21-14-10-15-22-31/h9-10,12-15,19-22,32-33H,4-8,11,16-18,23-29H2,1-3H3/t32-,33+,35-/m0/s1 |
| InChIKey | IIGFUKGAALWHOS-UJNSZXMOSA-N |
| XLogP | 7.69 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|