C34H53NO3 — CID 57248223
(1S,2R,4S)-N-heptan-2-yl-1-heptoxy-N-methyl-2,4-bis(phenylmethoxy)cyclopentan-1-amine (PubChem CID 57248223) has the molecular formula C34H53NO3 and a molecular weight of 523.80 g/mol. Its IUPAC name is (1S,2R,4S)-N-heptan-2-yl-1-heptoxy-N-methyl-2,4-bis(phenylmethoxy)cyclopentan-1-amine.
| Compound Name | (1S,2R,4S)-N-heptan-2-yl-1-heptoxy-N-methyl-2,4-bis(phenylmethoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 57248223 |
| Molecular Formula | C34H53NO3 |
| Molecular Weight | 523.80 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | (1S,2R,4S)-N-heptan-2-yl-1-heptoxy-N-methyl-2,4-bis(phenylmethoxy)cyclopentan-1-amine |
| SMILES | CCCCCCCO[C@@]1(N(C)C(C)CCCCC)C[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H53NO3/c1-5-7-9-10-18-24-38-34(35(4)29(3)19-13-8-6-2)26-32(36-27-30-20-14-11-15-21-30)25-33(34)37-28-31-22-16-12-17-23-31/h11-12,14-17,20-23,29,32-33H,5-10,13,18-19,24-28H2,1-4H3/t29?,32-,33+,34-/m0/s1 |
| InChIKey | AAMUFLOSVWFUPE-HSRUTRRWSA-N |
| XLogP | 8.53 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.80 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|