C33H49NO5 — CID 57054078
tert-butyl N-methyl-N-[(1S,2R,4S)-1-octoxy-2,4-bis(phenylmethoxy)cyclopentyl]carbamate (PubChem CID 57054078) has the molecular formula C33H49NO5 and a molecular weight of 539.76 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(1S,2R,4S)-1-octoxy-2,4-bis(phenylmethoxy)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(1S,2R,4S)-1-octoxy-2,4-bis(phenylmethoxy)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 57054078 |
| Molecular Formula | C33H49NO5 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | tert-butyl N-methyl-N-[(1S,2R,4S)-1-octoxy-2,4-bis(phenylmethoxy)cyclopentyl]carbamate |
| SMILES | CCCCCCCCO[C@@]1(N(C)C(=O)OC(C)(C)C)C[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H49NO5/c1-6-7-8-9-10-17-22-38-33(34(5)31(35)39-32(2,3)4)24-29(36-25-27-18-13-11-14-19-27)23-30(33)37-26-28-20-15-12-16-21-28/h11-16,18-21,29-30H,6-10,17,22-26H2,1-5H3/t29-,30+,33-/m0/s1 |
| InChIKey | DPFODFRBLGTCPN-VATRQPNGSA-N |
| XLogP | 7.89 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|