C32H47NO6 — CID 70584821
tert-butyl N-[(1R,2S,3R,5S)-2-(2-hydroxyheptoxy)-3,5-bis(phenylmethoxy)cyclopentyl]-N-methylcarbamate (PubChem CID 70584821) has the molecular formula C32H47NO6 and a molecular weight of 541.73 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3R,5S)-2-(2-hydroxyheptoxy)-3,5-bis(phenylmethoxy)cyclopentyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1R,2S,3R,5S)-2-(2-hydroxyheptoxy)-3,5-bis(phenylmethoxy)cyclopentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 70584821 |
| Molecular Formula | C32H47NO6 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | tert-butyl N-[(1R,2S,3R,5S)-2-(2-hydroxyheptoxy)-3,5-bis(phenylmethoxy)cyclopentyl]-N-methylcarbamate |
| SMILES | CCCCCC(O)CO[C@H]1[C@H](N(C)C(=O)OC(C)(C)C)[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H47NO6/c1-6-7-10-19-26(34)23-38-30-28(37-22-25-17-13-9-14-18-25)20-27(36-21-24-15-11-8-12-16-24)29(30)33(5)31(35)39-32(2,3)4/h8-9,11-18,26-30,34H,6-7,10,19-23H2,1-5H3/t26?,27-,28+,29+,30+/m0/s1 |
| InChIKey | CJLKGIMAEOVPQB-ULRKZYNGSA-N |
| XLogP | 6.12 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|