C40H52O6 — CID 70531560
7-[3,5-bis(phenylmethoxy)-2-[(2R)-2-phenylmethoxyheptoxy]cyclopentyl]hept-6-enoic acid (PubChem CID 70531560) has the molecular formula C40H52O6 and a molecular weight of 628.85 g/mol. Its IUPAC name is 7-[3,5-bis(phenylmethoxy)-2-[(2R)-2-phenylmethoxyheptoxy]cyclopentyl]hept-6-enoic acid.
| Compound Name | 7-[3,5-bis(phenylmethoxy)-2-[(2R)-2-phenylmethoxyheptoxy]cyclopentyl]hept-6-enoic acid |
|---|---|
| PubChem CID | 70531560 |
| Molecular Formula | C40H52O6 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 7-[3,5-bis(phenylmethoxy)-2-[(2R)-2-phenylmethoxyheptoxy]cyclopentyl]hept-6-enoic acid |
| SMILES | CCCCC[C@H](COC1C(OCc2ccccc2)CC(OCc2ccccc2)C1C=CCCCCC(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C40H52O6/c1-2-3-9-24-35(43-28-32-18-10-6-11-19-32)31-46-40-36(25-16-4-5-17-26-39(41)42)37(44-29-33-20-12-7-13-21-33)27-38(40)45-30-34-22-14-8-15-23-34/h6-8,10-16,18-23,25,35-38,40H,2-5,9,17,24,26-31H2,1H3,(H,41,42)/t35-,36?,37?,38?,40?/m1/s1 |
| InChIKey | XDQSJGQXFFNDOU-UVDFSUFSSA-N |
| XLogP | 8.93 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|