12-acetyloxy-5-phenylmethoxyoctadecanoic acid

C27H44O5 — CID 101300743

IUPAC12-acetyloxy-5-phenylmethoxyoctadecanoic acid
SMILESCCCCCCC(CCCCCCC(CCCC(=O)O)OCc1ccccc1)OC(C)=O
InChIInChI=1S/C27H44O5/c1-3-4-5-11-18-26(32-23(2)28)19-13-7-6-12-17-25(20-14-21-27(29)30)31-22-24-15-9-8-10-16-24/h8-10,15-16,25-26H,3-7,11-14,17-22H2,1-2H3,(H,29,30)
InChIKeyPMNKARXSIBKJDG-UHFFFAOYSA-N
MW448.64 g/mol
LogP7.07
Rot. Bonds20

About 12-acetyloxy-5-phenylmethoxyoctadecanoic acid

12-acetyloxy-5-phenylmethoxyoctadecanoic acid (PubChem CID 101300743) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is 12-acetyloxy-5-phenylmethoxyoctadecanoic acid.

Molecular Properties

Compound Name12-acetyloxy-5-phenylmethoxyoctadecanoic acid
PubChem CID101300743
Molecular FormulaC27H44O5
Molecular Weight448.64 g/mol
Exact Mass448.32
IUPAC Name12-acetyloxy-5-phenylmethoxyoctadecanoic acid
SMILESCCCCCCC(CCCCCCC(CCCC(=O)O)OCc1ccccc1)OC(C)=O
InChIInChI=1S/C27H44O5/c1-3-4-5-11-18-26(32-23(2)28)19-13-7-6-12-17-25(20-14-21-27(29)30)31-22-24-15-9-8-10-16-24/h8-10,15-16,25-26H,3-7,11-14,17-22H2,1-2H3,(H,29,30)
InChIKeyPMNKARXSIBKJDG-UHFFFAOYSA-N
XLogP7.07
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds20
Heavy Atoms32
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500448.64
LogP ≤ 57.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 12-acetyloxy-5-phenylmethoxyoctadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

11-acetyloxy-6-phenylmethoxyoctadecanoic acid
CID 101300775
13-acetyloxy-3-phenylmethoxyoctadecanoic acid
CID 101300677
bis(4-acetyloxy-10-phenylmethoxyoctadecanoate);barium(2+)
CID 101300896
3-acetyloxy-6-phenylmethoxyoctadecanoic acid
CID 101300759
13-acetyloxy-16-phenylmethoxyoctadecanoic acid
CID 101301119
6-acetyloxy-3-phenylmethoxyoctadecanoic acid
CID 101300663
5-hydroxy-12-phenylmethoxyoctadecanoic acid
CID 101300355
3-acetyloxy-14-phenylmethoxyoctadecanoic acid
CID 101301031
bis(9-acetyloxy-13-phenylmethoxyoctadecanoate);barium(2+)
CID 101301008
bis(6-acetyloxy-9-phenylmethoxyoctadecanoate);barium(2+)
CID 101300866
14-hydroxy-5-phenylmethoxyoctadecanoic acid
CID 101300135
10-hydroxy-6-phenylmethoxyoctadecanoic acid
CID 101300161

Frequently Asked Questions

What is the IUPAC name of 12-acetyloxy-5-phenylmethoxyoctadecanoic acid?
The IUPAC name of 12-acetyloxy-5-phenylmethoxyoctadecanoic acid (CID 101300743) is 12-acetyloxy-5-phenylmethoxyoctadecanoic acid.
What is the SMILES notation for 12-acetyloxy-5-phenylmethoxyoctadecanoic acid?
The canonical SMILES for 12-acetyloxy-5-phenylmethoxyoctadecanoic acid is CCCCCCC(CCCCCCC(CCCC(=O)O)OCc1ccccc1)OC(C)=O.
What is the InChIKey of 12-acetyloxy-5-phenylmethoxyoctadecanoic acid?
The InChIKey is PMNKARXSIBKJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44O5/c1-3-4-5-11-18-26(32-23(2)28)19-13-7-6-12-17-25(20-14-21-27(29)30)31-22-24-15-9-8-10-16-24/h8-10,15-16,25-26H,3-7,11-14,17-22H2,1-2H3,(H,29,30).
What are the key properties of 12-acetyloxy-5-phenylmethoxyoctadecanoic acid?
12-acetyloxy-5-phenylmethoxyoctadecanoic acid has a molecular weight of 448.64 g/mol, XLogP of 7.07, 20 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-acetyloxy-5-phenylmethoxyoctadecanoic acid is sourced from PubChem (CID 101300743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).