C27H44O5 — CID 101300677
13-acetyloxy-3-phenylmethoxyoctadecanoic acid (PubChem CID 101300677) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is 13-acetyloxy-3-phenylmethoxyoctadecanoic acid.
| Compound Name | 13-acetyloxy-3-phenylmethoxyoctadecanoic acid |
|---|---|
| PubChem CID | 101300677 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 13-acetyloxy-3-phenylmethoxyoctadecanoic acid |
| SMILES | CCCCCC(CCCCCCCCCC(CC(=O)O)OCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C27H44O5/c1-3-4-11-18-25(32-23(2)28)19-14-8-6-5-7-9-15-20-26(21-27(29)30)31-22-24-16-12-10-13-17-24/h10,12-13,16-17,25-26H,3-9,11,14-15,18-22H2,1-2H3,(H,29,30) |
| InChIKey | MXMDIIBQVXLRDQ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|