C54H86BaO10 — CID 101301008
bis(9-acetyloxy-13-phenylmethoxyoctadecanoate);barium(2+) (PubChem CID 101301008) has the molecular formula C54H86BaO10 and a molecular weight of 1032.60 g/mol. Its IUPAC name is bis(9-acetyloxy-13-phenylmethoxyoctadecanoate);barium(2+).
| Compound Name | bis(9-acetyloxy-13-phenylmethoxyoctadecanoate);barium(2+) |
|---|---|
| PubChem CID | 101301008 |
| Molecular Formula | C54H86BaO10 |
| Molecular Weight | 1032.60 g/mol |
| Exact Mass | 1032.53 |
| IUPAC Name | bis(9-acetyloxy-13-phenylmethoxyoctadecanoate);barium(2+) |
| SMILES | CCCCCC(CCCC(CCCCCCCC(=O)[O-])OC(C)=O)OCc1ccccc1.CCCCCC(CCCC(CCCCCCCC(=O)[O-])OC(C)=O)OCc1ccccc1.[Ba+2] |
| InChI | InChI=1S/2C27H44O5.Ba/c2*1-3-4-9-17-25(31-22-24-15-10-8-11-16-24)19-14-20-26(32-23(2)28)18-12-6-5-7-13-21-27(29)30;/h2*8,10-11,15-16,25-26H,3-7,9,12-14,17-22H2,1-2H3,(H,29,30);/q;;+2/p-2 |
| InChIKey | WHEXBPOWMKWDRA-UHFFFAOYSA-L |
| XLogP | 11.09 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.60 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|