C32H46O4 — CID 21397410
8-acetyl-8-phenyl-12-phenylmethoxyheptadecanoic acid (PubChem CID 21397410) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is 8-acetyl-8-phenyl-12-phenylmethoxyheptadecanoic acid.
| Compound Name | 8-acetyl-8-phenyl-12-phenylmethoxyheptadecanoic acid |
|---|---|
| PubChem CID | 21397410 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | 8-acetyl-8-phenyl-12-phenylmethoxyheptadecanoic acid |
| SMILES | CCCCCC(CCCC(CCCCCCC(=O)O)(C(C)=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H46O4/c1-3-4-9-21-30(36-26-28-17-10-7-11-18-28)22-16-25-32(27(2)33,29-19-12-8-13-20-29)24-15-6-5-14-23-31(34)35/h7-8,10-13,17-20,30H,3-6,9,14-16,21-26H2,1-2H3,(H,34,35) |
| InChIKey | OHYDUOXXQKYXOM-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|