C35H52O4 — CID 21397387
ethyl 8-acetyl-8-(2-methylphenyl)-12-phenylmethoxyheptadecanoate (PubChem CID 21397387) has the molecular formula C35H52O4 and a molecular weight of 536.80 g/mol. Its IUPAC name is ethyl 8-acetyl-8-(2-methylphenyl)-12-phenylmethoxyheptadecanoate.
| Compound Name | ethyl 8-acetyl-8-(2-methylphenyl)-12-phenylmethoxyheptadecanoate |
|---|---|
| PubChem CID | 21397387 |
| Molecular Formula | C35H52O4 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | ethyl 8-acetyl-8-(2-methylphenyl)-12-phenylmethoxyheptadecanoate |
| SMILES | CCCCCC(CCCC(CCCCCCC(=O)OCC)(C(C)=O)c1ccccc1C)OCc1ccccc1 |
| InChI | InChI=1S/C35H52O4/c1-5-7-11-22-32(39-28-31-20-12-10-13-21-31)23-18-27-35(30(4)36,33-24-16-15-19-29(33)3)26-17-9-8-14-25-34(37)38-6-2/h10,12-13,15-16,19-21,24,32H,5-9,11,14,17-18,22-23,25-28H2,1-4H3 |
| InChIKey | WHQYZYZHJJRKAP-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|