C35H55NO4 — CID 70583260
1-[(1R,2S,3R,5S)-2-[heptyl(methyl)amino]-3,5-bis(phenylmethoxy)cyclopentyl]oxy-2-methylheptan-2-ol (PubChem CID 70583260) has the molecular formula C35H55NO4 and a molecular weight of 553.83 g/mol. Its IUPAC name is 1-[(1R,2S,3R,5S)-2-[heptyl(methyl)amino]-3,5-bis(phenylmethoxy)cyclopentyl]oxy-2-methylheptan-2-ol.
| Compound Name | 1-[(1R,2S,3R,5S)-2-[heptyl(methyl)amino]-3,5-bis(phenylmethoxy)cyclopentyl]oxy-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 70583260 |
| Molecular Formula | C35H55NO4 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.41 |
| IUPAC Name | 1-[(1R,2S,3R,5S)-2-[heptyl(methyl)amino]-3,5-bis(phenylmethoxy)cyclopentyl]oxy-2-methylheptan-2-ol |
| SMILES | CCCCCCCN(C)[C@@H]1[C@@H](OCC(C)(O)CCCCC)[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H55NO4/c1-5-7-9-10-18-24-36(4)33-31(38-26-29-19-13-11-14-20-29)25-32(39-27-30-21-15-12-16-22-30)34(33)40-28-35(3,37)23-17-8-6-2/h11-16,19-22,31-34,37H,5-10,17-18,23-28H2,1-4H3/t31-,32+,33+,34+,35?/m1/s1 |
| InChIKey | FVGUKSZGSVRREY-VQXGLFPXSA-N |
| XLogP | 7.55 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|