C22H45NO3 — CID 70583774
(1S,3R,4S,5R)-4-heptoxy-5-[methyl(nonyl)amino]cyclopentane-1,3-diol (PubChem CID 70583774) has the molecular formula C22H45NO3 and a molecular weight of 371.61 g/mol. Its IUPAC name is (1S,3R,4S,5R)-4-heptoxy-5-[methyl(nonyl)amino]cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4S,5R)-4-heptoxy-5-[methyl(nonyl)amino]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70583774 |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | (1S,3R,4S,5R)-4-heptoxy-5-[methyl(nonyl)amino]cyclopentane-1,3-diol |
| SMILES | CCCCCCCCCN(C)[C@H]1[C@H](OCCCCCCC)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C22H45NO3/c1-4-6-8-10-11-12-14-16-23(3)21-19(24)18-20(25)22(21)26-17-15-13-9-7-5-2/h19-22,24-25H,4-18H2,1-3H3/t19-,20+,21+,22+/m0/s1 |
| InChIKey | MPDUBADJDRUZKN-DXBBTUNJSA-N |
| XLogP | 4.52 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|