About 4-hexoxypyrrolidin-3-ol
4-hexoxypyrrolidin-3-ol (PubChem CID 63701868) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 4-hexoxypyrrolidin-3-ol.
Molecular Properties
| Compound Name | 4-hexoxypyrrolidin-3-ol |
| PubChem CID | 63701868 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 4-hexoxypyrrolidin-3-ol |
| SMILES | CCCCCCOC1CNCC1O |
| InChI | InChI=1S/C10H21NO2/c1-2-3-4-5-6-13-10-8-11-7-9(10)12/h9-12H,2-8H2,1H3 |
| InChIKey | BQJZUNDTWIRWIN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxypyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxypyrrolidin-3-ol?
The IUPAC name of 4-hexoxypyrrolidin-3-ol (CID 63701868) is 4-hexoxypyrrolidin-3-ol.
What is the SMILES notation for 4-hexoxypyrrolidin-3-ol?
The canonical SMILES for 4-hexoxypyrrolidin-3-ol is CCCCCCOC1CNCC1O.
What is the InChIKey of 4-hexoxypyrrolidin-3-ol?
The InChIKey is BQJZUNDTWIRWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-2-3-4-5-6-13-10-8-11-7-9(10)12/h9-12H,2-8H2,1H3.
What are the key properties of 4-hexoxypyrrolidin-3-ol?
4-hexoxypyrrolidin-3-ol has a molecular weight of 187.28 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxypyrrolidin-3-ol is sourced from PubChem (CID 63701868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).